C8H18O6 — CID 90736618
2-ethylhexane-1,1,1,2,3,3-hexol (PubChem CID 90736618) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-ethylhexane-1,1,1,2,3,3-hexol.
| Compound Name | 2-ethylhexane-1,1,1,2,3,3-hexol |
|---|---|
| PubChem CID | 90736618 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-ethylhexane-1,1,1,2,3,3-hexol |
| SMILES | CCCC(O)(O)C(O)(CC)C(O)(O)O |
| InChI | InChI=1S/C8H18O6/c1-3-5-7(10,11)6(9,4-2)8(12,13)14/h9-14H,3-5H2,1-2H3 |
| InChIKey | ZSHNNJQLCFWFBL-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|