C20H13F2N4O+ — CID 90737165
5-(1-benzofuran-5-ylmethyl)-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium (PubChem CID 90737165) has the molecular formula C20H13F2N4O+ and a molecular weight of 363.35 g/mol. Its IUPAC name is 5-(1-benzofuran-5-ylmethyl)-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium.
| Compound Name | 5-(1-benzofuran-5-ylmethyl)-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium |
|---|---|
| PubChem CID | 90737165 |
| Molecular Formula | C20H13F2N4O+ |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 5-(1-benzofuran-5-ylmethyl)-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium |
| SMILES | Fc1cccc(-c2nc3cn[n+](Cc4ccc5occc5c4)cc3[nH]2)c1F |
| InChI | InChI=1S/C20H12F2N4O/c21-15-3-1-2-14(19(15)22)20-24-16-9-23-26(11-17(16)25-20)10-12-4-5-18-13(8-12)6-7-27-18/h1-9,11H,10H2/p+1 |
| InChIKey | LKCMBQUBQKWQKR-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 58.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|