C9H17NOS3 — CID 90737425
1-(3-ethyl-4-hydroxy-5-methyl-1,3-thiazolidin-2-yl)-2-sulfanylpropane-1-thione (PubChem CID 90737425) has the molecular formula C9H17NOS3 and a molecular weight of 251.44 g/mol. Its IUPAC name is 1-(3-ethyl-4-hydroxy-5-methyl-1,3-thiazolidin-2-yl)-2-sulfanylpropane-1-thione.
| Compound Name | 1-(3-ethyl-4-hydroxy-5-methyl-1,3-thiazolidin-2-yl)-2-sulfanylpropane-1-thione |
|---|---|
| PubChem CID | 90737425 |
| Molecular Formula | C9H17NOS3 |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 1-(3-ethyl-4-hydroxy-5-methyl-1,3-thiazolidin-2-yl)-2-sulfanylpropane-1-thione |
| SMILES | CCN1C(C(=S)C(C)S)SC(C)C1O |
| InChI | InChI=1S/C9H17NOS3/c1-4-10-8(11)6(3)14-9(10)7(13)5(2)12/h5-6,8-9,11-12H,4H2,1-3H3 |
| InChIKey | LNVGTCJORMWWAI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|