C26H26FNO — CID 90738088
3-(3-ethylphenyl)-2-[4-[1-(2-fluorophenyl)propylimino]but-2-en-2-yl]cyclopenta-2,4-dien-1-one (PubChem CID 90738088) has the molecular formula C26H26FNO and a molecular weight of 387.50 g/mol. Its IUPAC name is 3-(3-ethylphenyl)-2-[4-[1-(2-fluorophenyl)propylimino]but-2-en-2-yl]cyclopenta-2,4-dien-1-one.
| Compound Name | 3-(3-ethylphenyl)-2-[4-[1-(2-fluorophenyl)propylimino]but-2-en-2-yl]cyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 90738088 |
| Molecular Formula | C26H26FNO |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 3-(3-ethylphenyl)-2-[4-[1-(2-fluorophenyl)propylimino]but-2-en-2-yl]cyclopenta-2,4-dien-1-one |
| SMILES | CCc1cccc(C2=C(C(C)=C/C=N/C(CC)c3ccccc3F)C(=O)C=C2)c1 |
| InChI | InChI=1S/C26H26FNO/c1-4-19-9-8-10-20(17-19)21-13-14-25(29)26(21)18(3)15-16-28-24(5-2)22-11-6-7-12-23(22)27/h6-17,24H,4-5H2,1-3H3/b18-15?,28-16+ |
| InChIKey | SCDXJFJWVYHTEW-WTFMGTOUSA-N |
| XLogP | 6.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|