C26H22F5NO — CID 90888330
2-[5-(1,1-difluoroethyl)-2-phenyl-2H-pyrrol-3-yl]-6-[3-(trifluoromethyl)phenyl]hepta-1,4-dien-3-one (PubChem CID 90888330) has the molecular formula C26H22F5NO and a molecular weight of 459.46 g/mol. Its IUPAC name is 2-[5-(1,1-difluoroethyl)-2-phenyl-2H-pyrrol-3-yl]-6-[3-(trifluoromethyl)phenyl]hepta-1,4-dien-3-one.
| Compound Name | 2-[5-(1,1-difluoroethyl)-2-phenyl-2H-pyrrol-3-yl]-6-[3-(trifluoromethyl)phenyl]hepta-1,4-dien-3-one |
|---|---|
| PubChem CID | 90888330 |
| Molecular Formula | C26H22F5NO |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[5-(1,1-difluoroethyl)-2-phenyl-2H-pyrrol-3-yl]-6-[3-(trifluoromethyl)phenyl]hepta-1,4-dien-3-one |
| SMILES | C=C(C(=O)C=CC(C)c1cccc(C(F)(F)F)c1)C1=CC(C(C)(F)F)=NC1c1ccccc1 |
| InChI | InChI=1S/C26H22F5NO/c1-16(19-10-7-11-20(14-19)26(29,30)31)12-13-22(33)17(2)21-15-23(25(3,27)28)32-24(21)18-8-5-4-6-9-18/h4-16,24H,2H2,1,3H3 |
| InChIKey | JQINOBZMMVPXRD-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|