C28H32FN3O — CID 90738442
2-amino-3-[2-(2-fluoropropan-2-yl)phenyl]-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]propanamide (PubChem CID 90738442) has the molecular formula C28H32FN3O and a molecular weight of 445.58 g/mol. Its IUPAC name is 2-amino-3-[2-(2-fluoropropan-2-yl)phenyl]-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]propanamide.
| Compound Name | 2-amino-3-[2-(2-fluoropropan-2-yl)phenyl]-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]propanamide |
|---|---|
| PubChem CID | 90738442 |
| Molecular Formula | C28H32FN3O |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-amino-3-[2-(2-fluoropropan-2-yl)phenyl]-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]propanamide |
| SMILES | [H]/N=C(\C)C(Cc1ccc(-c2ccccc2)cc1)NC(=O)C(N)Cc1ccccc1C(C)(C)F |
| InChI | InChI=1S/C28H32FN3O/c1-19(30)26(17-20-13-15-22(16-14-20)21-9-5-4-6-10-21)32-27(33)25(31)18-23-11-7-8-12-24(23)28(2,3)29/h4-16,25-26,30H,17-18,31H2,1-3H3,(H,32,33)/b30-19+ |
| InChIKey | PRVWKNJCBRRJPM-NDZAJKAJSA-N |
| XLogP | 5.20 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|