C30H35N3O — CID 91408191
2-amino-3-(4-tert-butylphenyl)-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]but-3-enamide (PubChem CID 91408191) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-amino-3-(4-tert-butylphenyl)-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]but-3-enamide.
| Compound Name | 2-amino-3-(4-tert-butylphenyl)-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]but-3-enamide |
|---|---|
| PubChem CID | 91408191 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 2-amino-3-(4-tert-butylphenyl)-N-[3-imino-1-(4-phenylphenyl)butan-2-yl]but-3-enamide |
| SMILES | [H]/N=C(\C)C(Cc1ccc(-c2ccccc2)cc1)NC(=O)C(N)C(=C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H35N3O/c1-20(23-15-17-26(18-16-23)30(3,4)5)28(32)29(34)33-27(21(2)31)19-22-11-13-25(14-12-22)24-9-7-6-8-10-24/h6-18,27-28,31H,1,19,32H2,2-5H3,(H,33,34)/b31-21+ |
| InChIKey | AWTVSXXTRAQKHH-NJZRLIGZSA-N |
| XLogP | 5.76 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|