C14H15N3 — CID 90739302
deuteriomethane;7-methyl-2-phenyl-1H-imidazo[4,5-b]pyridine (PubChem CID 90739302) has the molecular formula C14H15N3 and a molecular weight of 226.30 g/mol. Its IUPAC name is deuteriomethane;7-methyl-2-phenyl-1H-imidazo[4,5-b]pyridine.
| Compound Name | deuteriomethane;7-methyl-2-phenyl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 90739302 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | deuteriomethane;7-methyl-2-phenyl-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccnc2nc(-c3ccccc3)[nH]c12.[2H]C |
| InChI | InChI=1S/C13H11N3.CH4/c1-9-7-8-14-13-11(9)15-12(16-13)10-5-3-2-4-6-10;/h2-8H,1H3,(H,14,15,16);1H4/i;1D |
| InChIKey | JYOSVJSQQYCDHD-DIYDOPDJSA-N |
| XLogP | 3.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |