C18H17N3O3S — CID 90739734
methyl 3-[5-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]thieno[2,3-c]pyridin-3-yl]prop-2-ynoate (PubChem CID 90739734) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 3-[5-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]thieno[2,3-c]pyridin-3-yl]prop-2-ynoate.
| Compound Name | methyl 3-[5-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]thieno[2,3-c]pyridin-3-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 90739734 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | methyl 3-[5-[[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]carbamoyl]thieno[2,3-c]pyridin-3-yl]prop-2-ynoate |
| SMILES | COC(=O)C#Cc1csc2cnc(C(=O)N[C@@H]3C[C@H]4CC[C@@H]3N4)cc12 |
| InChI | InChI=1S/C18H17N3O3S/c1-24-17(22)5-2-10-9-25-16-8-19-15(7-12(10)16)18(23)21-14-6-11-3-4-13(14)20-11/h7-9,11,13-14,20H,3-4,6H2,1H3,(H,21,23)/t11-,13+,14-/m1/s1 |
| InChIKey | WFPQLXBKLQZRJK-KWCYVHTRSA-N |
| XLogP | 1.44 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|