C15H15N3O2S — CID 90995852
N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-formylthieno[2,3-c]pyridine-5-carboxamide (PubChem CID 90995852) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-formylthieno[2,3-c]pyridine-5-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-formylthieno[2,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 90995852 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-2-formylthieno[2,3-c]pyridine-5-carboxamide |
| SMILES | O=Cc1cc2cc(C(=O)N[C@@H]3C[C@H]4CC[C@@H]3N4)ncc2s1 |
| InChI | InChI=1S/C15H15N3O2S/c19-7-10-3-8-4-13(16-6-14(8)21-10)15(20)18-12-5-9-1-2-11(12)17-9/h3-4,6-7,9,11-12,17H,1-2,5H2,(H,18,20)/t9-,11+,12-/m1/s1 |
| InChIKey | JRCJJGKVHZWMHG-ADEWGFFLSA-N |
| XLogP | 1.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|