C21H34O5 — CID 90740452
7-[(1R,2R,3R)-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid (PubChem CID 90740452) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90740452 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(3S,7R)-3,7-dihydroxyoct-1-enyl]-3-hydroxy-5-methylidenecyclopentyl]hept-5-enoic acid |
| SMILES | C=C1C[C@@H](O)[C@H](C=C[C@@H](O)CCC[C@@H](C)O)[C@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C21H34O5/c1-15-14-20(24)19(13-12-17(23)9-7-8-16(2)22)18(15)10-5-3-4-6-11-21(25)26/h3,5,12-13,16-20,22-24H,1,4,6-11,14H2,2H3,(H,25,26)/t16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | RYUMIYCNSLGMIE-LCWAXJCOSA-N |
| XLogP | 3.21 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|