C18H19BrClNO2 — CID 90741039
ethyl N-[4-(3-bromopropyl)-2-(4-chlorophenyl)phenyl]carbamate (PubChem CID 90741039) has the molecular formula C18H19BrClNO2 and a molecular weight of 396.71 g/mol. Its IUPAC name is ethyl N-[4-(3-bromopropyl)-2-(4-chlorophenyl)phenyl]carbamate.
| Compound Name | ethyl N-[4-(3-bromopropyl)-2-(4-chlorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 90741039 |
| Molecular Formula | C18H19BrClNO2 |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | ethyl N-[4-(3-bromopropyl)-2-(4-chlorophenyl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(CCCBr)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19BrClNO2/c1-2-23-18(22)21-17-10-5-13(4-3-11-19)12-16(17)14-6-8-15(20)9-7-14/h5-10,12H,2-4,11H2,1H3,(H,21,22) |
| InChIKey | JYFDRABQKRFDQQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|