C17H10F6N4O — CID 90741104
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yltriazole-4-carbaldehyde (PubChem CID 90741104) has the molecular formula C17H10F6N4O and a molecular weight of 400.28 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yltriazole-4-carbaldehyde.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yltriazole-4-carbaldehyde |
|---|---|
| PubChem CID | 90741104 |
| Molecular Formula | C17H10F6N4O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-pyridin-3-yltriazole-4-carbaldehyde |
| SMILES | O=Cc1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1cccnc1 |
| InChI | InChI=1S/C17H10F6N4O/c18-16(19,20)12-4-10(5-13(6-12)17(21,22)23)8-27-15(14(9-28)25-26-27)11-2-1-3-24-7-11/h1-7,9H,8H2 |
| InChIKey | ROIPHKCRONIZCP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|