C20H21N3O3 — CID 90741575
N-(3,5-dihydroxy-11,12-dimethyl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-trien-4-yl)-N-pyridin-4-ylacetamide (PubChem CID 90741575) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(3,5-dihydroxy-11,12-dimethyl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-trien-4-yl)-N-pyridin-4-ylacetamide.
| Compound Name | N-(3,5-dihydroxy-11,12-dimethyl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-trien-4-yl)-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 90741575 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(3,5-dihydroxy-11,12-dimethyl-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5,11-trien-4-yl)-N-pyridin-4-ylacetamide |
| SMILES | CC(=O)N(c1ccncc1)n1c(O)c2c(c1O)C1C(C)=C(C)C2C2CC12 |
| InChI | InChI=1S/C20H21N3O3/c1-9-10(2)16-14-8-13(14)15(9)17-18(16)20(26)23(19(17)25)22(11(3)24)12-4-6-21-7-5-12/h4-7,13-16,25-26H,8H2,1-3H3 |
| InChIKey | AQSAWCYDMRQKAV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|