C19H23ClFN2O+ — CID 9074227
[2-[[(5-chloro-2-fluorobenzoyl)amino]methyl]phenyl]methyl-diethylazanium (PubChem CID 9074227) has the molecular formula C19H23ClFN2O+ and a molecular weight of 349.86 g/mol. Its IUPAC name is [2-[[(5-chloro-2-fluorobenzoyl)amino]methyl]phenyl]methyl-diethylazanium.
| Compound Name | [2-[[(5-chloro-2-fluorobenzoyl)amino]methyl]phenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 9074227 |
| Molecular Formula | C19H23ClFN2O+ |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [2-[[(5-chloro-2-fluorobenzoyl)amino]methyl]phenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1ccccc1CNC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C19H22ClFN2O/c1-3-23(4-2)13-15-8-6-5-7-14(15)12-22-19(24)17-11-16(20)9-10-18(17)21/h5-11H,3-4,12-13H2,1-2H3,(H,22,24)/p+1 |
| InChIKey | CPICGQMQAMFITE-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |