C21H29N2O+ — CID 9073183
[2-[[(3,4-dimethylbenzoyl)amino]methyl]phenyl]methyl-diethylazanium (PubChem CID 9073183) has the molecular formula C21H29N2O+ and a molecular weight of 325.48 g/mol. Its IUPAC name is [2-[[(3,4-dimethylbenzoyl)amino]methyl]phenyl]methyl-diethylazanium.
| Compound Name | [2-[[(3,4-dimethylbenzoyl)amino]methyl]phenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 9073183 |
| Molecular Formula | C21H29N2O+ |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | [2-[[(3,4-dimethylbenzoyl)amino]methyl]phenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1ccccc1CNC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H28N2O/c1-5-23(6-2)15-20-10-8-7-9-19(20)14-22-21(24)18-12-11-16(3)17(4)13-18/h7-13H,5-6,14-15H2,1-4H3,(H,22,24)/p+1 |
| InChIKey | QGMJUULSCCCPQD-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |