C22H27N4O+ — CID 9074333
diethyl-[[2-[[(1-phenylpyrazole-4-carbonyl)amino]methyl]phenyl]methyl]azanium (PubChem CID 9074333) has the molecular formula C22H27N4O+ and a molecular weight of 363.49 g/mol. Its IUPAC name is diethyl-[[2-[[(1-phenylpyrazole-4-carbonyl)amino]methyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[2-[[(1-phenylpyrazole-4-carbonyl)amino]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9074333 |
| Molecular Formula | C22H27N4O+ |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | diethyl-[[2-[[(1-phenylpyrazole-4-carbonyl)amino]methyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1ccccc1CNC(=O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H26N4O/c1-3-25(4-2)16-19-11-9-8-10-18(19)14-23-22(27)20-15-24-26(17-20)21-12-6-5-7-13-21/h5-13,15,17H,3-4,14,16H2,1-2H3,(H,23,27)/p+1 |
| InChIKey | NVYDKGRLBLMCNM-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |