C21H30N3O3S+ — CID 9073364
[2-[[[4-(dimethylsulfamoyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium (PubChem CID 9073364) has the molecular formula C21H30N3O3S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is [2-[[[4-(dimethylsulfamoyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium.
| Compound Name | [2-[[[4-(dimethylsulfamoyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 9073364 |
| Molecular Formula | C21H30N3O3S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [2-[[[4-(dimethylsulfamoyl)benzoyl]amino]methyl]phenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1ccccc1CNC(=O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O3S/c1-5-24(6-2)16-19-10-8-7-9-18(19)15-22-21(25)17-11-13-20(14-12-17)28(26,27)23(3)4/h7-14H,5-6,15-16H2,1-4H3,(H,22,25)/p+1 |
| InChIKey | LNEZLOGTOIKVRB-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |