C21H26N2 — CID 90742395
1-benzyl-2-(3-phenylprop-2-enyl)-1,4-diazepane (PubChem CID 90742395) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-benzyl-2-(3-phenylprop-2-enyl)-1,4-diazepane.
| Compound Name | 1-benzyl-2-(3-phenylprop-2-enyl)-1,4-diazepane |
|---|---|
| PubChem CID | 90742395 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-benzyl-2-(3-phenylprop-2-enyl)-1,4-diazepane |
| SMILES | C(=Cc1ccccc1)CC1CNCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2/c1-3-9-19(10-4-1)13-7-14-21-17-22-15-8-16-23(21)18-20-11-5-2-6-12-20/h1-7,9-13,21-22H,8,14-18H2 |
| InChIKey | ZREPYNCZXHPDSW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |