C30H34ClN3O4 — CID 90742566
(Z)-but-2-enedioic acid;1-[(4-chlorophenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine (PubChem CID 90742566) has the molecular formula C30H34ClN3O4 and a molecular weight of 536.07 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[(4-chlorophenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine.
| Compound Name | (Z)-but-2-enedioic acid;1-[(4-chlorophenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 90742566 |
| Molecular Formula | C30H34ClN3O4 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[(4-chlorophenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine |
| SMILES | Cc1cc(-c2cc(CN3CCN(Cc4ccc(Cl)cc4)CC3)ccn2)cc(C)c1C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C26H30ClN3.C4H4O4/c1-19-14-24(15-20(2)21(19)3)26-16-23(8-9-28-26)18-30-12-10-29(11-13-30)17-22-4-6-25(27)7-5-22;5-3(6)1-2-4(7)8/h4-9,14-16H,10-13,17-18H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VNCZVHBHCWIPAE-BTJKTKAUSA-N |
| XLogP | 5.36 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|