C34H43N3O4 — CID 91054671
(Z)-but-2-enedioic acid;1-[(4-tert-butylphenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine (PubChem CID 91054671) has the molecular formula C34H43N3O4 and a molecular weight of 557.74 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[(4-tert-butylphenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine.
| Compound Name | (Z)-but-2-enedioic acid;1-[(4-tert-butylphenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 91054671 |
| Molecular Formula | C34H43N3O4 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[(4-tert-butylphenyl)methyl]-4-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperazine |
| SMILES | Cc1cc(-c2cc(CN3CCN(Cc4ccc(C(C)(C)C)cc4)CC3)ccn2)cc(C)c1C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C30H39N3.C4H4O4/c1-22-17-27(18-23(2)24(22)3)29-19-26(11-12-31-29)21-33-15-13-32(14-16-33)20-25-7-9-28(10-8-25)30(4,5)6;5-3(6)1-2-4(7)8/h7-12,17-19H,13-16,20-21H2,1-6H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | KZRQHAOZHOONDH-BTJKTKAUSA-N |
| XLogP | 6.00 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|