About 3-methoxy-2,5-dimethylhex-5-enal
3-methoxy-2,5-dimethylhex-5-enal (PubChem CID 90744251) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-methoxy-2,5-dimethylhex-5-enal.
Molecular Properties
| Compound Name | 3-methoxy-2,5-dimethylhex-5-enal |
| PubChem CID | 90744251 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 3-methoxy-2,5-dimethylhex-5-enal |
| SMILES | C=C(C)CC(OC)C(C)C=O |
| InChI | InChI=1S/C9H16O2/c1-7(2)5-9(11-4)8(3)6-10/h6,8-9H,1,5H2,2-4H3 |
| InChIKey | PNTHOLPANWGGKR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-2,5-dimethylhex-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,5-dimethylhex-5-enal?
The IUPAC name of 3-methoxy-2,5-dimethylhex-5-enal (CID 90744251) is 3-methoxy-2,5-dimethylhex-5-enal.
What is the SMILES notation for 3-methoxy-2,5-dimethylhex-5-enal?
The canonical SMILES for 3-methoxy-2,5-dimethylhex-5-enal is C=C(C)CC(OC)C(C)C=O.
What is the InChIKey of 3-methoxy-2,5-dimethylhex-5-enal?
The InChIKey is PNTHOLPANWGGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-7(2)5-9(11-4)8(3)6-10/h6,8-9H,1,5H2,2-4H3.
What are the key properties of 3-methoxy-2,5-dimethylhex-5-enal?
3-methoxy-2,5-dimethylhex-5-enal has a molecular weight of 156.22 g/mol, XLogP of 1.80, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,5-dimethylhex-5-enal is sourced from PubChem (CID 90744251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).