About 4-methoxy-3,6-dimethylhept-6-en-2-one
4-methoxy-3,6-dimethylhept-6-en-2-one (PubChem CID 90823803) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 4-methoxy-3,6-dimethylhept-6-en-2-one.
Molecular Properties
| Compound Name | 4-methoxy-3,6-dimethylhept-6-en-2-one |
| PubChem CID | 90823803 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 4-methoxy-3,6-dimethylhept-6-en-2-one |
| SMILES | C=C(C)CC(OC)C(C)C(C)=O |
| InChI | InChI=1S/C10H18O2/c1-7(2)6-10(12-5)8(3)9(4)11/h8,10H,1,6H2,2-5H3 |
| InChIKey | KZAMCTOMPAZKBY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-3,6-dimethylhept-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-3,6-dimethylhept-6-en-2-one?
The IUPAC name of 4-methoxy-3,6-dimethylhept-6-en-2-one (CID 90823803) is 4-methoxy-3,6-dimethylhept-6-en-2-one.
What is the SMILES notation for 4-methoxy-3,6-dimethylhept-6-en-2-one?
The canonical SMILES for 4-methoxy-3,6-dimethylhept-6-en-2-one is C=C(C)CC(OC)C(C)C(C)=O.
What is the InChIKey of 4-methoxy-3,6-dimethylhept-6-en-2-one?
The InChIKey is KZAMCTOMPAZKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-7(2)6-10(12-5)8(3)9(4)11/h8,10H,1,6H2,2-5H3.
What are the key properties of 4-methoxy-3,6-dimethylhept-6-en-2-one?
4-methoxy-3,6-dimethylhept-6-en-2-one has a molecular weight of 170.25 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-3,6-dimethylhept-6-en-2-one is sourced from PubChem (CID 90823803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).