C12H22O2 — CID 102142956
(5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-one (PubChem CID 102142956) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-one.
| Compound Name | (5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-one |
|---|---|
| PubChem CID | 102142956 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (5R,6R,7S)-6-methoxy-5,7-dimethylnon-1-en-4-one |
| SMILES | C=CCC(=O)[C@H](C)[C@H](OC)[C@@H](C)CC |
| InChI | InChI=1S/C12H22O2/c1-6-8-11(13)10(4)12(14-5)9(3)7-2/h6,9-10,12H,1,7-8H2,2-5H3/t9-,10-,12+/m0/s1 |
| InChIKey | OFIRQVRBRJYCNG-JBLDHEPKSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|