C13H22O3 — CID 59076121
(5R,6S)-5-methoxy-2,2,6-trimethyl-3-oxonon-8-enal (PubChem CID 59076121) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (5R,6S)-5-methoxy-2,2,6-trimethyl-3-oxonon-8-enal.
| Compound Name | (5R,6S)-5-methoxy-2,2,6-trimethyl-3-oxonon-8-enal |
|---|---|
| PubChem CID | 59076121 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (5R,6S)-5-methoxy-2,2,6-trimethyl-3-oxonon-8-enal |
| SMILES | C=CC[C@H](C)[C@@H](CC(=O)C(C)(C)C=O)OC |
| InChI | InChI=1S/C13H22O3/c1-6-7-10(2)11(16-5)8-12(15)13(3,4)9-14/h6,9-11H,1,7-8H2,2-5H3/t10-,11+/m0/s1 |
| InChIKey | USTYOPALCFMMER-WDEREUQCSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|