C15H26O3 — CID 20767046
5-methoxy-2,2,4,6,6-pentamethyl-3-oxonon-8-enal (PubChem CID 20767046) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 5-methoxy-2,2,4,6,6-pentamethyl-3-oxonon-8-enal.
| Compound Name | 5-methoxy-2,2,4,6,6-pentamethyl-3-oxonon-8-enal |
|---|---|
| PubChem CID | 20767046 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 5-methoxy-2,2,4,6,6-pentamethyl-3-oxonon-8-enal |
| SMILES | C=CCC(C)(C)C(OC)C(C)C(=O)C(C)(C)C=O |
| InChI | InChI=1S/C15H26O3/c1-8-9-14(3,4)13(18-7)11(2)12(17)15(5,6)10-16/h8,10-11,13H,1,9H2,2-7H3 |
| InChIKey | KOJFMZPTLNXJGW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|