C12H18FNO — CID 90745322
5-fluoro-1-(1-methylpiperidin-4-yl)hexa-2,5-dien-1-one (PubChem CID 90745322) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is 5-fluoro-1-(1-methylpiperidin-4-yl)hexa-2,5-dien-1-one.
| Compound Name | 5-fluoro-1-(1-methylpiperidin-4-yl)hexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 90745322 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 5-fluoro-1-(1-methylpiperidin-4-yl)hexa-2,5-dien-1-one |
| SMILES | C=C(F)CC=CC(=O)C1CCN(C)CC1 |
| InChI | InChI=1S/C12H18FNO/c1-10(13)4-3-5-12(15)11-6-8-14(2)9-7-11/h3,5,11H,1,4,6-9H2,2H3 |
| InChIKey | CDKDCXXEUIWWPX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|