C23H20N4O4 — CID 90745562
2-ethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 90745562) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-ethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90745562 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-ethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-5-carbonyl)phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1ccc(C(=O)c2ccc3c(c2)C(C=O)C(=O)N3)cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-3-27-20(10-13(2)26-27)23(31)24-16-7-4-14(5-8-16)21(29)15-6-9-19-17(11-15)18(12-28)22(30)25-19/h4-12,18H,3H2,1-2H3,(H,24,31)(H,25,30) |
| InChIKey | OBNCWRSCNRJKKH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|