C24H22N4O4 — CID 90967686
1,3-diethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]pyrazole-5-carboxamide (PubChem CID 90967686) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1,3-diethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]pyrazole-5-carboxamide.
| Compound Name | 1,3-diethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90967686 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1,3-diethyl-N-[4-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]pyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2ccc(C(=O)c3ccc4c(c3)NC(=O)C4C=O)cc2)n(CC)n1 |
| InChI | InChI=1S/C24H22N4O4/c1-3-16-12-21(28(4-2)27-16)24(32)25-17-8-5-14(6-9-17)22(30)15-7-10-18-19(13-29)23(31)26-20(18)11-15/h5-13,19H,3-4H2,1-2H3,(H,25,32)(H,26,31) |
| InChIKey | ZBQFPSFXRPYQLA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|