C26H18N4O4 — CID 91404069
N-[3-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]-2-phenylpyrazole-3-carboxamide (PubChem CID 91404069) has the molecular formula C26H18N4O4 and a molecular weight of 450.45 g/mol. Its IUPAC name is N-[3-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]-2-phenylpyrazole-3-carboxamide.
| Compound Name | N-[3-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]-2-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91404069 |
| Molecular Formula | C26H18N4O4 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-[3-(3-formyl-2-oxo-1,3-dihydroindole-6-carbonyl)phenyl]-2-phenylpyrazole-3-carboxamide |
| SMILES | O=CC1C(=O)Nc2cc(C(=O)c3cccc(NC(=O)c4ccnn4-c4ccccc4)c3)ccc21 |
| InChI | InChI=1S/C26H18N4O4/c31-15-21-20-10-9-17(14-22(20)29-25(21)33)24(32)16-5-4-6-18(13-16)28-26(34)23-11-12-27-30(23)19-7-2-1-3-8-19/h1-15,21H,(H,28,34)(H,29,33) |
| InChIKey | UZHSJRIWOKMJGM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|