C14H22FNO — CID 90745860
N,N-diethyl-2-[1-(2-fluorophenyl)ethoxy]ethanamine (PubChem CID 90745860) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is N,N-diethyl-2-[1-(2-fluorophenyl)ethoxy]ethanamine.
| Compound Name | N,N-diethyl-2-[1-(2-fluorophenyl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 90745860 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N,N-diethyl-2-[1-(2-fluorophenyl)ethoxy]ethanamine |
| SMILES | CCN(CC)CCOC(C)c1ccccc1F |
| InChI | InChI=1S/C14H22FNO/c1-4-16(5-2)10-11-17-12(3)13-8-6-7-9-14(13)15/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | OALDGWQBTRIPIW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |