C6H8N2O — CID 90746432
5,5-dimethylpyrazole-3-carbaldehyde (PubChem CID 90746432) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 5,5-dimethylpyrazole-3-carbaldehyde.
| Compound Name | 5,5-dimethylpyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 90746432 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 5,5-dimethylpyrazole-3-carbaldehyde |
| SMILES | CC1(C)C=C(C=O)N=N1 |
| InChI | InChI=1S/C6H8N2O/c1-6(2)3-5(4-9)7-8-6/h3-4H,1-2H3 |
| InChIKey | UCKJQMHHWQNWOS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|