C13H21N3 — CID 90746711
4-methyl-7-(4-methylpiperazin-1-yl)-4,5-dihydroazocine (PubChem CID 90746711) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-methyl-7-(4-methylpiperazin-1-yl)-4,5-dihydroazocine.
| Compound Name | 4-methyl-7-(4-methylpiperazin-1-yl)-4,5-dihydroazocine |
|---|---|
| PubChem CID | 90746711 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4-methyl-7-(4-methylpiperazin-1-yl)-4,5-dihydroazocine |
| SMILES | CC1C=C/N=C\C(N2CCN(C)CC2)=CC1 |
| InChI | InChI=1S/C13H21N3/c1-12-3-4-13(11-14-6-5-12)16-9-7-15(2)8-10-16/h4-6,11-12H,3,7-10H2,1-2H3/b6-5?,13-4?,14-11- |
| InChIKey | SXYIVAVBYXASMZ-ZHCIPITGSA-N |
| XLogP | 1.74 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |