C21H16ClFN4O2 — CID 90746942
N-(3-chlorophenyl)-N-[(8-fluoroisoquinolin-4-yl)methyl]-3-methyl-1-oxidoimidazol-1-ium-4-carboxamide (PubChem CID 90746942) has the molecular formula C21H16ClFN4O2 and a molecular weight of 410.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[(8-fluoroisoquinolin-4-yl)methyl]-3-methyl-1-oxidoimidazol-1-ium-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-N-[(8-fluoroisoquinolin-4-yl)methyl]-3-methyl-1-oxidoimidazol-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 90746942 |
| Molecular Formula | C21H16ClFN4O2 |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-(3-chlorophenyl)-N-[(8-fluoroisoquinolin-4-yl)methyl]-3-methyl-1-oxidoimidazol-1-ium-4-carboxamide |
| SMILES | Cn1c[n+]([O-])cc1C(=O)N(Cc1cncc2c(F)cccc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H16ClFN4O2/c1-25-13-26(29)12-20(25)21(28)27(16-5-2-4-15(22)8-16)11-14-9-24-10-18-17(14)6-3-7-19(18)23/h2-10,12-13H,11H2,1H3 |
| InChIKey | ALIGGIIORRBPQP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|