C10H16N2OS — CID 90747004
7-pentyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-one (PubChem CID 90747004) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 7-pentyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-one.
| Compound Name | 7-pentyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-one |
|---|---|
| PubChem CID | 90747004 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 7-pentyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]thiadiazol-3-one |
| SMILES | CCCCCC1CCn2c1nsc2=O |
| InChI | InChI=1S/C10H16N2OS/c1-2-3-4-5-8-6-7-12-9(8)11-14-10(12)13/h8H,2-7H2,1H3 |
| InChIKey | XQMTVKRVJMKYJV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|