C30H29F3N2O7 — CID 90747757
(4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90747757) has the molecular formula C30H29F3N2O7 and a molecular weight of 586.56 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90747757 |
| Molecular Formula | C30H29F3N2O7 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-3,10,12a-trihydroxy-1,11,12-trioxo-7-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(/C=C/c5ccc(C(F)(F)F)cc5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C30H29F3N2O7/c1-35(2)23-18-12-15-11-17-14(6-3-13-4-8-16(9-5-13)30(31,32)33)7-10-19(36)21(17)24(37)20(15)26(39)29(18,42)27(40)22(25(23)38)28(34)41/h3-10,15,18,20,22-23,25,36,38,42H,11-12H2,1-2H3,(H2,34,41)/b6-3+/t15-,18-,20?,22?,23-,25?,29-/m1/s1 |
| InChIKey | QIWNQMUXZYGHDA-UZIDAJMNSA-N |
| XLogP | 1.85 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|