About (4-aminopyrimidin-5-yl) formate
(4-aminopyrimidin-5-yl) formate (PubChem CID 90748314) has the molecular formula C5H5N3O2
and a molecular weight of 139.11 g/mol. Its IUPAC name is (4-aminopyrimidin-5-yl) formate.
Molecular Properties
| Compound Name | (4-aminopyrimidin-5-yl) formate |
| PubChem CID | 90748314 |
| Molecular Formula | C5H5N3O2 |
| Molecular Weight | 139.11 g/mol |
| Exact Mass | 139.04 |
| IUPAC Name | (4-aminopyrimidin-5-yl) formate |
| SMILES | Nc1ncncc1OC=O |
| InChI | InChI=1S/C5H5N3O2/c6-5-4(10-3-9)1-7-2-8-5/h1-3H,(H2,6,7,8) |
| InChIKey | IDBQDCMOARKOSM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.11 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-aminopyrimidin-5-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminopyrimidin-5-yl) formate?
The IUPAC name of (4-aminopyrimidin-5-yl) formate (CID 90748314) is (4-aminopyrimidin-5-yl) formate.
What is the SMILES notation for (4-aminopyrimidin-5-yl) formate?
The canonical SMILES for (4-aminopyrimidin-5-yl) formate is Nc1ncncc1OC=O.
What is the InChIKey of (4-aminopyrimidin-5-yl) formate?
The InChIKey is IDBQDCMOARKOSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2/c6-5-4(10-3-9)1-7-2-8-5/h1-3H,(H2,6,7,8).
What are the key properties of (4-aminopyrimidin-5-yl) formate?
(4-aminopyrimidin-5-yl) formate has a molecular weight of 139.11 g/mol, XLogP of -0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminopyrimidin-5-yl) formate is sourced from PubChem (CID 90748314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).