C9H8NS+ — CID 90749721
5-methyl-4-methylidene-3aH-1,3-benzothiazole (PubChem CID 90749721) has the molecular formula C9H8NS+ and a molecular weight of 162.24 g/mol. Its IUPAC name is 5-methyl-4-methylidene-3aH-1,3-benzothiazole.
| Compound Name | 5-methyl-4-methylidene-3aH-1,3-benzothiazole |
|---|---|
| PubChem CID | 90749721 |
| Molecular Formula | C9H8NS+ |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 5-methyl-4-methylidene-3aH-1,3-benzothiazole |
| SMILES | [H]/[C+]=C1\C(C)=CC=C2SC=NC21 |
| InChI | InChI=1S/C9H8NS/c1-6-3-4-8-9(7(6)2)10-5-11-8/h2-5,9H,1H3/q+1 |
| InChIKey | FSWIAHOQCCCOPA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|