C16H21N5O — CID 90750270
5-(butylaminomethyl)-2-phenyl-3a,6-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 90750270) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 5-(butylaminomethyl)-2-phenyl-3a,6-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-(butylaminomethyl)-2-phenyl-3a,6-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 90750270 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 5-(butylaminomethyl)-2-phenyl-3a,6-dihydro-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCCNCC1=NC2N=C(c3ccccc3)NN2C(=O)C1 |
| InChI | InChI=1S/C16H21N5O/c1-2-3-9-17-11-13-10-14(22)21-16(18-13)19-15(20-21)12-7-5-4-6-8-12/h4-8,16-17H,2-3,9-11H2,1H3,(H,19,20) |
| InChIKey | BOEIZETZOWOOMN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|