C16H26N4S — CID 173445165
N-butylbutan-1-amine;5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 173445165) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is N-butylbutan-1-amine;5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | N-butylbutan-1-amine;5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 173445165 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-butylbutan-1-amine;5-phenyl-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCCCNCCCC.S=c1nc(-c2ccccc2)[nH][nH]1 |
| InChI | InChI=1S/C8H7N3S.C8H19N/c12-8-9-7(10-11-8)6-4-2-1-3-5-6;1-3-5-7-9-8-6-4-2/h1-5H,(H2,9,10,11,12);9H,3-8H2,1-2H3 |
| InChIKey | KHVBEHMKGWNIST-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|