C14H8ClF5N2O — CID 90751133
1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,3-difluorophenyl)urea (PubChem CID 90751133) has the molecular formula C14H8ClF5N2O and a molecular weight of 350.67 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,3-difluorophenyl)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,3-difluorophenyl)urea |
|---|---|
| PubChem CID | 90751133 |
| Molecular Formula | C14H8ClF5N2O |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(2,3-difluorophenyl)urea |
| SMILES | NC(=O)N(c1ccc(Cl)c(C(F)(F)F)c1)c1cccc(F)c1F |
| InChI | InChI=1S/C14H8ClF5N2O/c15-9-5-4-7(6-8(9)14(18,19)20)22(13(21)23)11-3-1-2-10(16)12(11)17/h1-6H,(H2,21,23) |
| InChIKey | RNTADSNEZXUPPG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |