C19H15ClF3N5O — CID 67162073
1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(N-methyl-3-pyrimidin-5-ylanilino)urea (PubChem CID 67162073) has the molecular formula C19H15ClF3N5O and a molecular weight of 421.81 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(N-methyl-3-pyrimidin-5-ylanilino)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(N-methyl-3-pyrimidin-5-ylanilino)urea |
|---|---|
| PubChem CID | 67162073 |
| Molecular Formula | C19H15ClF3N5O |
| Molecular Weight | 421.81 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-(N-methyl-3-pyrimidin-5-ylanilino)urea |
| SMILES | CN(c1cccc(-c2cncnc2)c1)N(C(N)=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15ClF3N5O/c1-27(14-4-2-3-12(7-14)13-9-25-11-26-10-13)28(18(24)29)15-5-6-17(20)16(8-15)19(21,22)23/h2-11H,1H3,(H2,24,29) |
| InChIKey | CBJHKAZQICUVNS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|