C21H16ClF3N2O3 — CID 59708543
[3-(5-methoxy-3-pyridinyl)phenyl]methyl N-[4-chloro-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 59708543) has the molecular formula C21H16ClF3N2O3 and a molecular weight of 436.82 g/mol. Its IUPAC name is [3-(5-methoxy-3-pyridinyl)phenyl]methyl N-[4-chloro-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [3-(5-methoxy-3-pyridinyl)phenyl]methyl N-[4-chloro-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 59708543 |
| Molecular Formula | C21H16ClF3N2O3 |
| Molecular Weight | 436.82 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | [3-(5-methoxy-3-pyridinyl)phenyl]methyl N-[4-chloro-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | COc1cncc(-c2cccc(COC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C21H16ClF3N2O3/c1-29-17-8-15(10-26-11-17)14-4-2-3-13(7-14)12-30-20(28)27-16-5-6-19(22)18(9-16)21(23,24)25/h2-11H,12H2,1H3,(H,27,28) |
| InChIKey | QUJWRZBEDBDOPQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.82 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |