C24H17ClF3N3O — CID 154236821
1-[4-chloro-3-(trifluoromethyl)phenyl]-1-[(4-isoquinolin-4-ylphenyl)methyl]urea (PubChem CID 154236821) has the molecular formula C24H17ClF3N3O and a molecular weight of 455.87 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-[(4-isoquinolin-4-ylphenyl)methyl]urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-[(4-isoquinolin-4-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 154236821 |
| Molecular Formula | C24H17ClF3N3O |
| Molecular Weight | 455.87 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-1-[(4-isoquinolin-4-ylphenyl)methyl]urea |
| SMILES | NC(=O)N(Cc1ccc(-c2cncc3ccccc23)cc1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17ClF3N3O/c25-22-10-9-18(11-21(22)24(26,27)28)31(23(29)32)14-15-5-7-16(8-6-15)20-13-30-12-17-3-1-2-4-19(17)20/h1-13H,14H2,(H2,29,32) |
| InChIKey | XOSIELLHWNLESE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.87 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |