C18H13BrF3N3O — CID 174496833
1-[[3-bromo-4-(trifluoromethyl)phenyl]methyl]-1-isoquinolin-5-ylurea (PubChem CID 174496833) has the molecular formula C18H13BrF3N3O and a molecular weight of 424.22 g/mol. Its IUPAC name is 1-[[3-bromo-4-(trifluoromethyl)phenyl]methyl]-1-isoquinolin-5-ylurea.
| Compound Name | 1-[[3-bromo-4-(trifluoromethyl)phenyl]methyl]-1-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 174496833 |
| Molecular Formula | C18H13BrF3N3O |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 1-[[3-bromo-4-(trifluoromethyl)phenyl]methyl]-1-isoquinolin-5-ylurea |
| SMILES | NC(=O)N(Cc1ccc(C(F)(F)F)c(Br)c1)c1cccc2cnccc12 |
| InChI | InChI=1S/C18H13BrF3N3O/c19-15-8-11(4-5-14(15)18(20,21)22)10-25(17(23)26)16-3-1-2-12-9-24-7-6-13(12)16/h1-9H,10H2,(H2,23,26) |
| InChIKey | RWFYNCBRYLWBIL-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |