C20H17ClF3N3O — CID 91119736
1-(1-chloro-3-ethylisoquinolin-5-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 91119736) has the molecular formula C20H17ClF3N3O and a molecular weight of 407.82 g/mol. Its IUPAC name is 1-(1-chloro-3-ethylisoquinolin-5-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(1-chloro-3-ethylisoquinolin-5-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 91119736 |
| Molecular Formula | C20H17ClF3N3O |
| Molecular Weight | 407.82 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 1-(1-chloro-3-ethylisoquinolin-5-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CCc1cc2c(N(Cc3ccc(C(F)(F)F)cc3)C(N)=O)cccc2c(Cl)n1 |
| InChI | InChI=1S/C20H17ClF3N3O/c1-2-14-10-16-15(18(21)26-14)4-3-5-17(16)27(19(25)28)11-12-6-8-13(9-7-12)20(22,23)24/h3-10H,2,11H2,1H3,(H2,25,28) |
| InChIKey | ZQSYDFBQAMQCOC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|