C6H7Cl2N — CID 90751600
2,3-dichloro-5-methyl-2,3-dihydropyridine (PubChem CID 90751600) has the molecular formula C6H7Cl2N and a molecular weight of 164.03 g/mol. Its IUPAC name is 2,3-dichloro-5-methyl-2,3-dihydropyridine.
| Compound Name | 2,3-dichloro-5-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 90751600 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | 2,3-dichloro-5-methyl-2,3-dihydropyridine |
| SMILES | CC1=CC(Cl)C(Cl)N=C1 |
| InChI | InChI=1S/C6H7Cl2N/c1-4-2-5(7)6(8)9-3-4/h2-3,5-6H,1H3 |
| InChIKey | BWHLFXMTOBGLOZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|