C21H36N2O3 — CID 90752427
1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol (PubChem CID 90752427) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol.
| Compound Name | 1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90752427 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 1-[2-(1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
| SMILES | C=C(Cc1cc(O)n(CCN2CCOC2)c1O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H36N2O3/c1-16(13-21(5,6)14-20(2,3)4)11-17-12-18(24)23(19(17)25)8-7-22-9-10-26-15-22/h12,24-25H,1,7-11,13-15H2,2-6H3 |
| InChIKey | CPJRKXXZFFXRJN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|