C10H15NO3 — CID 54168805
1-(oxiran-2-ylmethyl)-3-propylpyrrole-2,5-diol (PubChem CID 54168805) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-(oxiran-2-ylmethyl)-3-propylpyrrole-2,5-diol.
| Compound Name | 1-(oxiran-2-ylmethyl)-3-propylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54168805 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-(oxiran-2-ylmethyl)-3-propylpyrrole-2,5-diol |
| SMILES | CCCc1cc(O)n(CC2CO2)c1O |
| InChI | InChI=1S/C10H15NO3/c1-2-3-7-4-9(12)11(10(7)13)5-8-6-14-8/h4,8,12-13H,2-3,5-6H2,1H3 |
| InChIKey | OTOKHNMYRQUZFC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|