C13H15N2O5- — CID 9075506
2-[4-[(Z)-C-ethyl-N-(methoxycarbonylamino)carbonimidoyl]phenoxy]acetate (PubChem CID 9075506) has the molecular formula C13H15N2O5- and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-[4-[(Z)-C-ethyl-N-(methoxycarbonylamino)carbonimidoyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-C-ethyl-N-(methoxycarbonylamino)carbonimidoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9075506 |
| Molecular Formula | C13H15N2O5- |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[4-[(Z)-C-ethyl-N-(methoxycarbonylamino)carbonimidoyl]phenoxy]acetate |
| SMILES | CC/C(=N/NC(=O)OC)c1ccc(OCC(=O)[O-])cc1 |
| InChI | InChI=1S/C13H16N2O5/c1-3-11(14-15-13(18)19-2)9-4-6-10(7-5-9)20-8-12(16)17/h4-7H,3,8H2,1-2H3,(H,15,18)(H,16,17)/p-1/b14-11- |
| InChIKey | OOFUBNNYVPGRMJ-KAMYIIQDSA-M |
| XLogP | 0.29 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|